| Product Name | Dimethallyl sulphide |
| CAS No. | 52444-06-1 |
| Synonyms | Bis(2-methyl-2-propenyl) sulphide~Methallyl sulphide; 2-methyl-3-[(2-methylprop-2-en-1-yl)sulfanyl]prop-1-ene |
| InChI | InChI=1/C8H14S/c1-7(2)5-9-6-8(3)4/h1,3,5-6H2,2,4H3 |
| Molecular Formula | C8H14S |
| Molecular Weight | 142.2618 |
| Density | 0.865g/cm3 |
| Boiling point | 186.8°C at 760 mmHg |
| Flash point | 57°C |
| Refractive index | 1.474 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
52444-06-1 dimethallyl sulphide
service@apichina.com