| Product Name | Diisopropylcyanamide |
| CAS No. | 3085-76-5 |
| Synonyms | dipropan-2-ylcyanamide |
| InChI | InChI=1/C7H14N2/c1-6(2)9(5-8)7(3)4/h6-7H,1-4H3 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.1995 |
| Density | 0.867g/cm3 |
| Boiling point | 193.3°C at 760 mmHg |
| Flash point | 78.9°C |
| Refractive index | 1.435 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
3085-76-5 diisopropylcyanamide
service@apichina.com