| Product Name | Diisopropyl chloromalonate |
| CAS No. | 195209-93-9 |
| Synonyms | Chloromalonic acid diisopropyl ester; bis(1-methylethyl) chloropropanedioate |
| InChI | InChI=1/C9H15ClO4/c1-5(2)13-8(11)7(10)9(12)14-6(3)4/h5-7H,1-4H3 |
| Molecular Formula | C9H15ClO4 |
| Molecular Weight | 222.666 |
| Density | 1.132g/cm3 |
| Boiling point | 238.1°C at 760 mmHg |
| Flash point | 83.3°C |
| Refractive index | 1.442 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
195209-93-9 diisopropyl chloromalonate
service@apichina.com