| Product Name | diisooctyl phthalate |
| CAS No. | 27554-26-3 |
| Synonyms | diisooctyl phthalate, mixed isomers; diiso-octyl phthalate; diiso-octyl orthophthalate; 1,2-Benzenedicarboxylic Acid Diisoctyl Ester; Di-iso-octyl phthalate; bis(6-methylheptyl) benzene-1,2-dicarboxylate; Phthalate Dioctyl |
| InChI | InChI=1/C24H38O4/c1-19(2)13-7-5-11-17-27-23(25)21-15-9-10-16-22(21)24(26)28-18-12-6-8-14-20(3)4/h9-10,15-16,19-20H,5-8,11-14,17-18H2,1-4H3 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.5561 |
| Density | 0.983g/cm3 |
| Boiling point | 384.9°C at 760 mmHg |
| Flash point | 204.5°C |
| Refractive index | 1.488 |
| Risk Codes | R2:Risk of explosion by shock, friction, fire or other sources of ignition.; R24/25:Toxic in contact with skin and if swallowed.; |
| Safety | S2:; S24/25:; |
27554-26-3 diisooctyl phthalate
service@apichina.com