| Product Name | Difluorophenylpiperazine |
| CAS No. | 115761-79-0 |
| Synonyms | 1-(2,4-Difluorophenyl)piperazine; 4-(2,4-difluorophenyl)piperazin-1-ium |
| InChI | InChI=1/C10H12F2N2/c11-8-1-2-10(9(12)7-8)14-5-3-13-4-6-14/h1-2,7,13H,3-6H2/p+1 |
| Molecular Formula | C10H13F2N2 |
| Molecular Weight | 199.2199 |
| Boiling point | 293.2°C at 760 mmHg |
| Flash point | 131.1°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
115761-79-0 difluorophenylpiperazine
service@apichina.com