| Product Name | Difluoromandelicacid |
| CAS No. | 132741-29-8 |
| Synonyms | 3,4-Difluoromandelic acid; (3,4-difluorophenyl)(hydroxy)acetic acid |
| InChI | InChI=1/C8H6F2O3/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| Molecular Formula | C8H6F2O3 |
| Molecular Weight | 188.1282 |
| Density | 1.522g/cm3 |
| Melting point | 92-94℃ |
| Boiling point | 320.7°C at 760 mmHg |
| Flash point | 147.8°C |
| Refractive index | 1.542 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
132741-29-8 difluoromandelicacid
service@apichina.com