| Product Name | Diethylstilbestrol |
| CAS No. | 56-53-1;6898-97-1 |
| Synonyms | Stilboestrol; a,a-Diethyl-4,4-Stilbenediol Carc.; Atovaquone; 4,4'-(3E)-hex-3-ene-3,4-diyldiphenol; 4,4'-(3Z)-hex-3-ene-3,4-diyldiphenol; diethylstilbestrol, mixture of cis and trans; ; Diethylstilbestrol,mixture of cis and trans; Diethylstilbestrol BP |
| InChI | InChI=1/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3/b18-17- |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.3502 |
| Density | 1.107g/cm3 |
| Melting point | 169-175℃ |
| Boiling point | 407.1°C at 760 mmHg |
| Flash point | 187°C |
| Water solubility | PRACTICALLY INSOLUBLE |
| Refractive index | 1.603 |
| Hazard Symbols | |
| Risk Codes | R40:; R45:; R61:; R36/37/38:; R51/53:; |
| Safety | S36/37/39:; S45:; S53:; S60:; S61:; |
56-53-1;6898-97-1 diethylstilbestrol
service@apichina.com