| Product Name | diethylenetriamine-pentaacetic acid dianhydride |
| CAS No. | 23911-26-4 |
| Synonyms | Diethylenetriaminepentaacetic acid dianhydride; DTPA Dianhydride; N,N-bis[2-(2,6-dioxomorpholin-4-yl)ethyl]glycine |
| InChI | InChI=1/C14H19N3O8/c18-10(19)5-15(1-3-16-6-11(20)24-12(21)7-16)2-4-17-8-13(22)25-14(23)9-17/h1-9H2,(H,18,19) |
| Molecular Formula | C14H19N3O8 |
| Molecular Weight | 357.316 |
| Density | 1.46g/cm3 |
| Melting point | 190-184℃ |
| Boiling point | 656.2°C at 760 mmHg |
| Flash point | 350.6°C |
| Refractive index | 1.558 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
23911-26-4 diethylenetriamine-pentaacetic acid dianhydride
service@apichina.com