| Product Name | Diethylene glycol dimethacrylate |
| CAS No. | 2358-84-1;129011-76-3 |
| Synonyms | 2-propenoic acid, 2-methyl-, oxydi-2,1-ethanediyl ester; Oxydi-2,1-ethanediyl bis(2-methylacrylate); Oxydiethane-2,1-diyl bis(2-methylacrylate); oxydiethane-2,1-diyl bis(2-methylprop-2-enoate); Diethyene Glycol Dimethacrylate |
| InChI | InChI=1/C12H18O5/c1-9(2)11(13)16-7-5-15-6-8-17-12(14)10(3)4/h1,3,5-8H2,2,4H3 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 |
| Density | 1.082 |
| Boiling point | 134℃ (2 mmHg) |
| Flash point | >110℃ |
| Refractive index | 1.458 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; |
2358-84-1;129011-76-3 diethylene glycol dimethacrylate
service@apichina.com