| Product Name | Diethyl suberate |
| CAS No. | 2050-23-9 |
| Synonyms | Diethyl suberate, (Diethyl octanedioate; Suberic acid d; 2050-23-9Diethyl suberate; Diethyl octanedioate~Suberic acid diethyl ester; Octanedioic acid diethyl ester~Suberic acid diethyl ester; diethyl octanedioate |
| InChI | InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.3007 |
| Density | 0.985g/cm3 |
| Melting point | 5-284℃ |
| Boiling point | 282.6°C at 760 mmHg |
| Flash point | 123.3°C |
| Refractive index | 1.436 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
2050-23-9 diethyl suberate
service@apichina.com