| Product Name | Diethyl sec-Butylmalonate |
| CAS No. | 83-27-2 |
| Synonyms | Butylmalonicaciddiethylester; sec-Butylmalonic acid diethyl ester; diethyl butan-2-ylpropanedioate; diethyl [(1S)-1-methylpropyl]propanedioate; diethyl [(1R)-1-methylpropyl]propanedioate |
| InChI | InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.2741 |
| Density | 0.992g/cm3 |
| Boiling point | 247.5°C at 760 mmHg |
| Flash point | 103.1°C |
| Refractive index | 1.431 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
83-27-2 diethyl sec-butylmalonate
service@apichina.com
- Next:83-28-3 2-isovalerylindan-1,3-dione
- Previous:83-26-1 pindone