| Product Name | diethyl hydrogen phosphate, compound with triethylamine (1:1) |
| CAS No. | 5802-76-6 |
| Synonyms | Phosphoric acid, diethyl ester, compd. with N,N-diethylethanamine (1:1); Phosphoric acid, diethyl ester, triethylamine salt; Diethyl hydrogen phosphate, compound with triethylamine (1:1); diethyl hydrogen phosphate - N,N-diethylethanamine (1:1) |
| InChI | InChI=1/C6H15N.C4H11O4P/c1-4-7(5-2)6-3;1-3-7-9(5,6)8-4-2/h4-6H2,1-3H3;3-4H2,1-2H3,(H,5,6) |
| Molecular Formula | C10H26NO4P |
| Molecular Weight | 255.2915 |
| Boiling point | 200.3°C at 760 mmHg |
| Flash point | 74.9°C |
5802-76-6 diethyl hydrogen phosphate, compound with triethylamine (1:1)
service@apichina.com