| Product Name | diethyl hydrogen phosphate, compound with N,N-dimethyldodecylamine (1:1) |
| CAS No. | 6428-00-8 |
| Synonyms | Phosphoric acid, diethyl ester, compd. with N,N-dimethyl-1-dodecanamine (1:1); Diethyl hydrogen phosphate, compound with N,N-dimethyldodecylamine(1:1); diethyl hydrogen phosphate - N,N-dimethyldodecan-1-amine (1:1) |
| InChI | InChI=1/C14H31N.C4H11O4P/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;1-3-7-9(5,6)8-4-2/h4-14H2,1-3H3;3-4H2,1-2H3,(H,5,6) |
| Molecular Formula | C18H42NO4P |
| Molecular Weight | 367.5041 |
| Boiling point | 265.2°C at 760 mmHg |
| Flash point | 106.9°C |
6428-00-8 diethyl hydrogen phosphate, compound with n,n-dimethyldodecylamine (1:1)
service@apichina.com