| Product Name | diethyl glutaconate, mixture of cis and tra |
| CAS No. | 2049-67-4 |
| Synonyms | Diethyl glutaconate,mixture of cis and trans; diethyl pent-2-enedioate; diethyl (2E)-pent-2-enedioate; diethyl (2Z)-pent-2-enedioate; 2-Pentenedioic acid,1,5-diethyl ester; Diethyl glutaconate |
| InChI | InChI=1/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5- |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.2051 |
| Density | 1.048g/cm3 |
| Boiling point | 237°C at 760 mmHg |
| Flash point | 106.7°C |
| Refractive index | 1.445 |
2049-67-4 diethyl glutaconate, mixture of cis and tra
service@apichina.com