| Product Name | Diethyl chlorophosphite |
| CAS No. | 589-57-1 |
| Synonyms | Diethyl chlorophosphonite; Diethyl phosphorochloridite; Ethyl phosphorochloridite; diethyl phosphorochloridoite |
| InChI | InChI=1/C4H10ClO2P/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3 |
| Molecular Formula | C4H10ClO2P |
| Molecular Weight | 156.5478 |
| Boiling point | 154°C at 760 mmHg |
| Flash point | 1.1°C |
| Hazard Symbols | |
| Risk Codes | R11:Highly flammable.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24/25:Avoid contact with skin and eyes.; |
589-57-1 diethyl chlorophosphite
service@apichina.com
- Next:589-59-3 isobutyl isovalerate
- Previous:589-55-9 4-heptanol