| Product Name | Diethyl azelate |
| CAS No. | 624-17-9 |
| Synonyms | Diethyl azelate, (Azelaic acid diethyl ester; Diethyl; Azelaic acid diethyl ester~Nonanedioic acid diethyl ester; diethyl nonanedioate |
| InChI | InChI=1/C13H24O4/c1-3-16-12(14)10-8-6-5-7-9-11-13(15)17-4-2/h3-11H2,1-2H3 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.3273 |
| Density | 0.976g/cm3 |
| Boiling point | 291.5°C at 760 mmHg |
| Flash point | 129.2°C |
| Refractive index | 1.439 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
624-17-9 diethyl azelate
service@apichina.com