| Product Name | Diethyl acetylmalonate |
| CAS No. | 570-08-1 |
| Synonyms | Acetylmalonic acid diethyl ester; (2-ethylbutanoyl)propanedioate |
| InChI | InChI=1/C9H14O5/c1-3-5(4-2)7(10)6(8(11)12)9(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/p-2 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.1897 |
| Boiling point | 372.3°C at 760 mmHg |
| Flash point | 193.1°C |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
570-08-1 diethyl acetylmalonate
service@apichina.com