| Product Name | diethyl (3-chloropropyl)malonate |
| CAS No. | 18719-43-2 |
| Synonyms | (3-Chloropropyl)malonic acid diethyl ester; diethyl (3-chloropropyl)propanedioate |
| InChI | InChI=1/C10H17ClO4/c1-3-14-9(12)8(6-5-7-11)10(13)15-4-2/h8H,3-7H2,1-2H3 |
| Molecular Formula | C10H17ClO4 |
| Molecular Weight | 236.6926 |
| Density | 1.114g/cm3 |
| Boiling point | 290.2°C at 760 mmHg |
| Flash point | 111.9°C |
| Refractive index | 1.447 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
18719-43-2 diethyl (3-chloropropyl)malonate
service@apichina.com