| Product Name | diethyl (2,4-dinitrophenyl)propanedioate |
| CAS No. | 4950-04-3 |
| Synonyms | Diethyl (2,4-dinitrophenyl)malonate; propanedioic acid, 2-(2,4-dinitrophenyl)-, diethyl ester |
| InChI | InChI=1/C13H14N2O8/c1-3-22-12(16)11(13(17)23-4-2)9-6-5-8(14(18)19)7-10(9)15(20)21/h5-7,11H,3-4H2,1-2H3 |
| Molecular Formula | C13H14N2O8 |
| Molecular Weight | 326.2589 |
| Density | 1.381g/cm3 |
| Boiling point | 452.3°C at 760 mmHg |
| Flash point | 189.6°C |
| Refractive index | 1.553 |
4950-04-3 diethyl (2,4-dinitrophenyl)propanedioate
service@apichina.com