| Product Name | diethyl 1-benzylpyrrolidine-2,5-dicarboxylate |
| CAS No. | 17740-40-8 |
| InChI | InChI=1/C17H23NO4/c1-3-21-16(19)14-10-11-15(17(20)22-4-2)18(14)12-13-8-6-5-7-9-13/h5-9,14-15H,3-4,10-12H2,1-2H3 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.3688 |
| Density | 1.146g/cm3 |
| Boiling point | 381.3°C at 760 mmHg |
| Flash point | 184.4°C |
| Refractive index | 1.53 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
17740-40-8 diethyl 1-benzylpyrrolidine-2,5-dicarboxylate
service@apichina.com