| Product Name | diethyl 1,2,3,6-tetrahydropyridazine-1,2-dicarboxylate |
| CAS No. | 35691-30-6 |
| Synonyms | diethyl 3,6-dihydropyridazine-1,2-dicarboxylate |
| InChI | InChI=1/C10H16N2O4/c1-3-15-9(13)11-7-5-6-8-12(11)10(14)16-4-2/h5-6H,3-4,7-8H2,1-2H3 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.245 |
| Density | 1.2g/cm3 |
| Boiling point | 288.3°C at 760 mmHg |
| Flash point | 128.2°C |
| Refractive index | 1.504 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
35691-30-6 diethyl 1,2,3,6-tetrahydropyridazine-1,2-dicarboxylate
service@apichina.com