| Product Name | Dicyclopentadiene |
| CAS No. | 77-73-6 |
| Synonyms | 3a,4,7,7a-Tetrahydro-4,7-methanoindene; Cyclopentadiene dimer~3a,4,7,7a-Tetrahydro-4,7-methanoindene; DCPD; dicyclopentadiene (stabilized with bht); Dicyclopentadiene (>95%); Dicyclopentadiene (70%); Dicyopentadiene; Dicyclopentadiene (80%); Dicyclopentadiene dimer |
| InChI | InChI=1/C10H12/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,4-5,7-10H,3,6H2 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.2 |
| Density | 0.982 |
| Melting point | -1℃ |
| Boiling point | 170℃ |
| Flash point | 26℃ |
| Refractive index | 1.51-1.512 |
| Hazard Symbols |  F:Flammable;  Xn:Harmful;  N:Dangerous for the environment; |
| Risk Codes | R11:; R20/22:; R36/37/38:; R51/53:; |
| Safety | S36/37:; S61:; |
77-73-6 dicyclopentadiene
service@apichina.com