| Product Name | Dicumarol |
| CAS No. | 66-76-2 |
| InChI | InChI=1/C19H12O6/c20-16-10-5-1-3-7-14(10)24-18(22)12(16)9-13-17(21)11-6-2-4-8-15(11)25-19(13)23/h1-8,20-21H,9H2 |
| Molecular Formula | C19H12O6 |
| Molecular Weight | 336.295 |
| Density | 1.573g/cm3 |
| Melting point | 290-292℃ |
| Boiling point | 620.702°C at 760 mmHg |
| Flash point | 231.949°C |
| Refractive index | 1.731 |
| Hazard Symbols | |
| Risk Codes | R22:Harmful if swallowed.; R48/25:Toxic : danger of serious damage to health by prolonged exposure if swallowed.; R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S37:Wear suitable gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
66-76-2 dicumarol
service@apichina.com
- Next:66-77-3 1-naphthaldehyde
- Previous:66-75-1 uramustine