| Product Name | Dichloroacetic anhydride |
| CAS No. | 4124-30-5 |
| Synonyms | Acetic acid, 2,2-dichloro-, 1,1'-anhydride; 4-02-00-00503 (Beilstein Handbook Reference); Anhydrid kyseliny dichloroctove; Anhydrid kyseliny dichloroctove [Czech]; BRN 0512173; Dichloroacetic acid anhydride; NSC 401832; 2,2'-Dichloroacetic anhydride; Acetic acid, dichloro-, anhydride |
| InChI | InChI=1/C4H2Cl4O3/c5-1(6)3(9)11-4(10)2(7)8/h1-2H |
| Molecular Formula | C4H2Cl4O3 |
| Molecular Weight | 239.8689 |
| Density | 1.695g/cm3 |
| Melting point | 29℃ |
| Boiling point | 215°C at 760 mmHg |
| Flash point | 90.6°C |
| Refractive index | 1.501 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R21:Harmful in contact with skin.; R34:Causes burns.; |
| Safety | S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
4124-30-5 dichloroacetic anhydride
service@apichina.com