| Product Name | Dibutylethylenediamine |
| CAS No. | 3529-09-7 |
| Synonyms | 1,2-ethanediamine, N~1~,N~1~-dibutyl-; 2-Dibutylaminoethylamine; 2-di-n-Butylaminoethylamine; N,N-Dibutylethane-1,2-diamine |
| InChI | InChI=1/C10H24N2/c1-3-5-8-12(10-7-11)9-6-4-2/h3-11H2,1-2H3 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.311 |
| Density | 0.842g/cm3 |
| Boiling point | 218.6°C at 760 mmHg |
| Flash point | 87.8°C |
| Refractive index | 1.456 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
3529-09-7 dibutylethylenediamine
service@apichina.com