| Product Name | dibutyl hydrogen phosphorate, compound with 4-tetrapropyleneaniline (1:1) |
| CAS No. | 68127-32-2 |
| Synonyms | Phosphoric acid, dibutyl ester, compd. with 4-tetrapropylenebenzenamine (1:1); Dibutyl hydrogen phosphorate, compound with 4-tetrapropyleneaniline (1:1); dibutyl hydrogen phosphate - 4-dodecylaniline (1:1) |
| InChI | InChI=1/C18H31N.C8H19O4P/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-15-18(19)16-14-17;1-3-5-7-11-13(9,10)12-8-6-4-2/h13-16H,2-12,19H2,1H3;3-8H2,1-2H3,(H,9,10) |
| Molecular Formula | C26H50NO4P |
| Molecular Weight | 471.6533 |
| Boiling point | 364°C at 760 mmHg |
| Flash point | 162.7°C |
68127-32-2 dibutyl hydrogen phosphorate, compound with 4-tetrapropyleneaniline (1:1)
service@apichina.com