| Product Name | dibutyl hydrogen phosphite, compound with methyl-1H-benzotriazole (1:1) |
| CAS No. | 67845-60-7 |
| Synonyms | Phosphorous acid, dibutyl ester, compd. with 6(or 7)-methyl-1H-benzotriazole (1:1); Dibutyl hydrogen phosphonate, tolyltriazole salt; Dibutyl hydrogen phosphite, compound with methyl-1H-benzotriazole (1:1); Phosphorous acid, dibutyl ester, compd. with methyl-1H-benzotriazole (1:1); dibutyl hydrogen phosphite - 5-methyl-2H-benzotriazole (1:1) |
| InChI | InChI=1/C8H19O3P.C7H7N3/c1-3-5-7-10-12(9)11-8-6-4-2;1-5-2-3-6-7(4-5)9-10-8-6/h9H,3-8H2,1-2H3;2-4H,1H3,(H,8,9,10) |
| Molecular Formula | C15H26N3O3P |
| Molecular Weight | 327.359 |
| Boiling point | 279°C at 760 mmHg |
| Flash point | 122.6°C |
67845-60-7 dibutyl hydrogen phosphite, compound with methyl-1h-benzotriazole (1:1)
service@apichina.com