| Product Name | dibenzylamine, compound with boron trifluoride (1:1) |
| CAS No. | 7445-38-7 |
| Synonyms | Boron, trifluoro(N-(phenylmethyl)benzenemethanamine)-, (T-4)-; Boron trifluoridedibenzylamine complex; Dibenzylamine, boron trifluoride complex (1:1); Boron, trifluoro(N-(phenylmethyl)benzenemethanamine)-, (beta-4)-; Dibenzylamine, compound with boron trifluoride (1:1); boron fluoride - N-benzyl-1-phenylmethanamine (1:3:1) |
| InChI | InChI=1/C14H15N.B.3FH/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;;;;/h1-10,15H,11-12H2;;3*1H/q;+3;;;/p-3 |
| Molecular Formula | C14H15BF3N |
| Molecular Weight | 265.0818 |
| Boiling point | 300°C at 760 mmHg |
| Flash point | 143.3°C |
7445-38-7 dibenzylamine, compound with boron trifluoride (1:1)
service@apichina.com