| Product Name | dibenzyl phthalate |
| CAS No. | 523-31-9 |
| Synonyms | Dibenzyl phthalate, (Phthalic acid dibenzyl ester); Phthalic acid dibenzyl ester; dibenzyl benzene-1,3-dicarboxylate |
| InChI | InChI=1/C22H18O4/c23-21(25-15-17-8-3-1-4-9-17)19-12-7-13-20(14-19)22(24)26-16-18-10-5-2-6-11-18/h1-14H,15-16H2 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.3759 |
| Density | 1.208g/cm3 |
| Boiling point | 493.8°C at 760 mmHg |
| Flash point | 248.8°C |
| Refractive index | 1.605 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
523-31-9 dibenzyl phthalate
service@apichina.com