| Product Name | Dibenzyl malonate |
| CAS No. | 15014-25-2 |
| Synonyms | Dibenzylmalonateca; Malonic acid dibenzyl ester~Propanedioic acid dibenzyl ester; 2,5-Dimethyl-3-Hezine-Diol; dibenzyl propanedioate |
| InChI | InChI=1/C17H16O4/c18-16(20-12-14-7-3-1-4-8-14)11-17(19)21-13-15-9-5-2-6-10-15/h1-10H,11-13H2 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.3065 |
| Density | 1.187g/cm3 |
| Boiling point | 445.3°C at 760 mmHg |
| Flash point | 190.8°C |
| Refractive index | 1.562 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
15014-25-2 dibenzyl malonate
service@apichina.com