| Product Name | Dibenzyl 5-aminoisophthalate |
| CAS No. | 152699-63-3 |
| Synonyms | 5-Aminoisophthalic acid dibenzyl ester~Dibenzyl 5-aminobenzene-1,3-dicarboxylate; 5-Aminobenzene-1,3-dicarboxylic acid dibenzyl ester~5-Aminoisophthalic acid dibenzyl ester; dibenzyl 5-aminobenzene-1,3-dicarboxylate |
| InChI | InChI=1/C22H19NO4/c23-20-12-18(21(24)26-14-16-7-3-1-4-8-16)11-19(13-20)22(25)27-15-17-9-5-2-6-10-17/h1-13H,14-15,23H2 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.3906 |
| Density | 1.25g/cm3 |
| Boiling point | 561.3°C at 760 mmHg |
| Flash point | 233.1°C |
| Refractive index | 1.631 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
152699-63-3 dibenzyl 5-aminoisophthalate
service@apichina.com