| Product Name | Dibenzothiophene-4-boronic acid |
| CAS No. | 108847-20-7 |
| Synonyms | Dibenzo[b,d]thiophen-4-ylboronic acid; 4-Dibenzothienylboronic acid; 4-DIBENZOTHIOPHENEBORONIC ACID |
| InChI | InChI=1/C12H9BO2S/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h1-7,14-15H |
| Molecular Formula | C12H9BO2S |
| Molecular Weight | 228.0747 |
| Density | 1.38g/cm3 |
| Melting point | 327-330℃ |
| Boiling point | 480.2°C at 760 mmHg |
| Flash point | 244.2°C |
| Refractive index | 1.738 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:; S24/25:; |
108847-20-7 dibenzothiophene-4-boronic acid
service@apichina.com