| Product Name | Dibenzo-30-crown-10 |
| CAS No. | 17455-25-3 |
| Synonyms | Dibenzo-30-crown 10-ether; 6,7,9,10,12,13,15,16,23,24,26,27,29,30,32,33-hexadecahydrodibenzo[b,q][1,4,7,10,13,16,19,22,25,28]decaoxacyclotriacontine |
| InChI | InChI=1/C28H40O10/c1-2-6-26-25(5-1)35-21-17-31-13-9-29-11-15-33-19-23-37-27-7-3-4-8-28(27)38-24-20-34-16-12-30-10-14-32-18-22-36-26/h1-8H,9-24H2 |
| Molecular Formula | C28H40O10 |
| Molecular Weight | 536.6112 |
| Density | 1.068g/cm3 |
| Melting point | 104℃ |
| Boiling point | 671°C at 760 mmHg |
| Flash point | 259°C |
| Refractive index | 1.465 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
17455-25-3 dibenzo-30-crown-10
service@apichina.com