| Product Name | Diallylphenylphosphine |
| CAS No. | 29949-75-5 |
| Synonyms | phenyl(diprop-2-en-1-yl)phosphane |
| InChI | InChI=1/C12H15P/c1-3-10-13(11-4-2)12-8-6-5-7-9-12/h3-9H,1-2,10-11H2 |
| Molecular Formula | C12H15P |
| Molecular Weight | 190.2213 |
| Boiling point | 256.5°C at 760 mmHg |
| Flash point | 112.4°C |
| Hazard Symbols |  F:Highly flammable;  Xi:Irritant; |
| Risk Codes | R17:Spontaneously flammable in air.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
29949-75-5 diallylphenylphosphine
service@apichina.com