| Product Name | Diallyl maleate |
| CAS No. | 999-21-3 |
| Synonyms | Diallyl maleate, (Maleic acid diallyl ester); Maleic acid diallyl ester; diprop-2-en-1-yl (2Z)-but-2-enedioate |
| InChI | InChI=1/C10H12O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h3-6H,1-2,7-8H2/b6-5- |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.1999 |
| Density | 1.064g/cm3 |
| Boiling point | 263.7°C at 760 mmHg |
| Flash point | 124.6°C |
| Refractive index | 1.469 |
| Risk Codes | R21/22:Harmful in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
999-21-3 diallyl maleate
service@apichina.com