| Product Name | Diallyl adipate |
| CAS No. | 2998-04-1 |
| Synonyms | Diallyl adipate, (Adipic acid diallyl ester); Adipic acid diallyl ester; diprop-2-en-1-yl hexanedioate |
| InChI | InChI=1/C12H18O4/c1-3-9-15-11(13)7-5-6-8-12(14)16-10-4-2/h3-4H,1-2,5-10H2 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.2689 |
| Density | 1.011g/cm3 |
| Boiling point | 288.4°C at 760 mmHg |
| Flash point | 133.8°C |
| Refractive index | 1.454 |
| Risk Codes | R21/22:Harmful in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
2998-04-1 diallyl adipate
service@apichina.com