| Product Name | di2-thienylmethanone oxime |
| CAS No. | 10558-44-8 |
| Synonyms | Bis(2-thienyl) ketoxime; Di-2-thienylmethanone oxime; dithiophen-2-ylmethanone oxime |
| InChI | InChI=1/C9H7NOS2/c11-10-9(7-3-1-5-12-7)8-4-2-6-13-8/h1-6,11H |
| Molecular Formula | C9H7NOS2 |
| Molecular Weight | 209.288 |
| Density | 1.38g/cm3 |
| Melting point | 125℃ |
| Boiling point | 361.1°C at 760 mmHg |
| Flash point | 172.2°C |
| Refractive index | 1.698 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
10558-44-8 di2-thienylmethanone oxime
service@apichina.com