| Product Name | di-sec-butylamine |
| CAS No. | 626-23-3 |
| Synonyms | Di-sec-butylamine,mixture of (? and meso; Dibutylamine,99%; N-(butan-2-yl)butan-2-amine |
| InChI | InChI=1/C8H19N/c1-5-7(3)9-8(4)6-2/h7-9H,5-6H2,1-4H3 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.2432 |
| Density | 0.759g/cm3 |
| Boiling point | 137.4°C at 760 mmHg |
| Flash point | 19.1°C |
| Refractive index | 1.415 |
| Hazard Symbols |  F:Flammable;  C:Corrosive; |
| Risk Codes | R11:; R20/21/22:; R34:; |
| Safety | S16:; S26:; S27:; S33:; S36/37/39:; S45:; |
626-23-3 di-sec-butylamine
service@apichina.com