| Product Name | Di-n-propylaminoacetonitrile |
| CAS No. | 18071-35-7 |
| Synonyms | Dipropylaminoacetonitrile |
| InChI | InChI=1/C8H16N2/c1-3-6-10(7-4-2)8-5-9/h3-4,6-8H2,1-2H3 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.226 |
| Density | 0.869g/cm3 |
| Boiling point | 217.6°C at 760 mmHg |
| Flash point | 76.3°C |
| Refractive index | 1.443 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
18071-35-7 di-n-propylaminoacetonitrile
service@apichina.com