| Product Name | Di-n-propyl sulphite |
| CAS No. | 623-98-3 |
| InChI | InChI=1/C6H14O3S/c1-3-5-8-10(7)9-6-4-2/h3-6H2,1-2H3 |
| Molecular Formula | C6H14O3S |
| Molecular Weight | 166.23 |
| Density | 1.03 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
623-98-3 di-n-propyl sulphite
service@apichina.com