| Product Name | Di-n-butylethylamine |
| CAS No. | 4458-33-7 |
| Synonyms | N-Ethyldibutylamine; N-butyl-N-ethylbutan-1-amine |
| InChI | InChI=1/C10H23N/c1-4-7-9-11(6-3)10-8-5-2/h4-10H2,1-3H3 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.2963 |
| Density | 0.783g/cm3 |
| Boiling point | 182.8°C at 760 mmHg |
| Flash point | 52.6°C |
| Refractive index | 1.432 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
4458-33-7 di-n-butylethylamine
service@apichina.com