| Product Name | di(methacrylic) acid, diester with butanediol |
| CAS No. | 38684-65-0 |
| Synonyms | 2-Propenoic acid, 2-methyl-, diester with butanediol; Butylene glycol dimethacrylate; Di(methacrylic) acid, diester with butanediol; butane-1,4-diyl bis(2-methylprop-2-enoate); 1-hydroxy-2-methylidenebutyl 2-[(1E)-but-1-en-1-yloxy]prop-2-enoate |
| InChI | InChI=1/C12H18O4/c1-5-7-8-15-10(4)12(14)16-11(13)9(3)6-2/h7-8,11,13H,3-6H2,1-2H3/b8-7+ |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.2689 |
| Density | 1.039g/cm3 |
| Boiling point | 326.7°C at 760 mmHg |
| Flash point | 116.8°C |
| Refractive index | 1.479 |
38684-65-0 di(methacrylic) acid, diester with butanediol
service@apichina.com