| Product Name | di(isooctadecanoic) acid, diester with glycerol |
| CAS No. | 68958-48-5 |
| Synonyms | Glyceryl diisostearate; Isooctadecanoic acid, diester with 1,2,3-propanetriol; glyceryl di-isostearate; Glycerol diisostearate; Di(isooctadecanoic) acid, diester with glycerol; 3-hydroxypropane-1,2-diyl bis(16-methylheptadecanoate) |
| InChI | InChI=1/C39H76O5/c1-35(2)29-25-21-17-13-9-5-7-11-15-19-23-27-31-38(41)43-34-37(33-40)44-39(42)32-28-24-20-16-12-8-6-10-14-18-22-26-30-36(3)4/h35-37,40H,5-34H2,1-4H3 |
| Molecular Formula | C39H76O5 |
| Molecular Weight | 625.0177 |
| Density | 0.921g/cm3 |
| Boiling point | 656.6°C at 760 mmHg |
| Flash point | 179.7°C |
| Refractive index | 1.465 |
68958-48-5 di(isooctadecanoic) acid, diester with glycerol
service@apichina.com