| Product Name | Di-iso-pentylamine = Di-iso-amylamine |
| CAS No. | 544-00-3 |
| Synonyms | Bis(3-methylbutyl)amine~Diisopentylamine; 3-methyl-N-(3-methylbutyl)butan-1-amine |
| InChI | InChI=1/C10H23N/c1-9(2)5-7-11-8-6-10(3)4/h9-11H,5-8H2,1-4H3 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.2963 |
| Density | 0.774g/cm3 |
| Boiling point | 188°C at 760 mmHg |
| Flash point | 46.6°C |
| Refractive index | 1.424 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
544-00-3 di-iso-pentylamine = di-iso-amylamine
service@apichina.com