| Product Name | Di-2-pyridyl ketone |
| CAS No. | 19437-26-4 |
| Synonyms | Dipyridylketone; Di(2-pyridyl)ketone; dipyridin-2-ylmethanone |
| InChI | InChI=1/C11H8N2O/c14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10/h1-8H |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.194 |
| Density | 1.196g/cm3 |
| Melting point | 52-55℃ |
| Boiling point | 343.5°C at 760 mmHg |
| Flash point | 165.7°C |
| Refractive index | 1.593 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
19437-26-4 di-2-pyridyl ketone
service@apichina.com