| Product Name | di-2-naphthyl ether |
| CAS No. | 613-80-9 |
| Synonyms | Dinaphthylether; 2,2-Dinaphthyl ether; 2-Naphthyl ether; 2,2'-oxydinaphthalene |
| InChI | InChI=1/C20H14O/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14H |
| Molecular Formula | C20H14O |
| Molecular Weight | 270.3246 |
| Density | 1.184g/cm3 |
| Boiling point | 449.9°C at 760 mmHg |
| Flash point | 226.1°C |
| Refractive index | 1.701 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
613-80-9 di-2-naphthyl ether
service@apichina.com