| Product Name | Desyl chloride |
| CAS No. | 447-31-4 |
| Synonyms | alpha-Chloro-alpha-phenylacetophenone; alpha-chlorodeoxybenzoin; 2-chloro-1,2-diphenylethanone; (2R)-2-chloro-1,2-diphenylethanone; (2S)-2-chloro-1,2-diphenylethanone |
| InChI | InChI=1/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H/t13-/m0/s1 |
| Molecular Formula | C14H11ClO |
| Molecular Weight | 230.6895 |
| Density | 1.19g/cm3 |
| Melting point | 65-69℃ |
| Boiling point | 345.5°C at 760 mmHg |
| Flash point | 190.4°C |
| Refractive index | 1.592 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; R37:Irritating to respiratory system.; |
| Safety | S22:Do not inhale dust.; S24:Avoid contact with skin.; |
447-31-4 desyl chloride
service@apichina.com