| Product Name | Desoxyanisoin |
| CAS No. | 120-44-5 |
| Synonyms | 4-Methoxy-2-(4-methoxyphenyl)acetophenone; Desoxyanisoin~4-Methoxybenzyl 4-methoxyphenyl ketone; 4,4-dimethoxydeoxybenzoin; 4-methoxybenzyl 4-methoxyphenyl ketone; Deoxyanisoin; 1,2-bis(4-methoxyphenyl)ethanone |
| InChI | InChI=1/C16H16O3/c1-18-14-7-3-12(4-8-14)11-16(17)13-5-9-15(19-2)10-6-13/h3-10H,11H2,1-2H3 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.2964 |
| Density | 1.115g/cm3 |
| Melting point | 109-112℃ |
| Boiling point | 415.6°C at 760 mmHg |
| Flash point | 196.9°C |
| Refractive index | 1.558 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
120-44-5 desoxyanisoin
service@apichina.com