| Product Name | Decanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol, carboxymethylated, disodium salts |
| CAS No. | 70750-05-9 |
| Synonyms | Decanoic acid, reaction products with 2-((2-aminoethyl)amino)ethanol, carboxymethylated, disodium salts; Capric acid, aminoethylethanolamine reaction product, carboxymethylated, sodium salt; sodium decanoate - 2-[(2-aminoethyl)amino]ethanol (1:1:1) |
| InChI | InChI=1/C10H20O2.C4H12N2O.Na/c1-2-3-4-5-6-7-8-9-10(11)12;5-1-2-6-3-4-7;/h2-9H2,1H3,(H,11,12);6-7H,1-5H2;/q;;+1/p-1 |
| Molecular Formula | C14H31N2NaO3 |
| Molecular Weight | 298.3973 |
| Boiling point | 269.6°C at 760 mmHg |
| Flash point | 121.8°C |
70750-05-9 decanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol, carboxymethylated,
service@apichina.com