| Product Name | Decanoic acid, mixed esters with octanoic acid and pentaerythritol |
| CAS No. | 68441-68-9 |
| Synonyms | Pentaerythrityl tetracaprylate/caprate; Octanoic acid, decanoic acid, pentaerythritol ester; Pentaerythritol caprylic acid capric acid mixed esters; Pentaerythritol, caprylate caprate tetraester; Saturated straight chain (C8 and C10) fatty acid pentaerythritol ester; 2,2-bis(hydroxymethyl)propane-1,3-diol; decanoic acid; octanoic acid |
| InChI | InChI=1/C10H20O2.C8H16O2.C5H12O4/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;6-1-5(2-7,3-8)4-9/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);6-9H,1-4H2 |
| Molecular Formula | C23H48O8 |
| Molecular Weight | 452.6224 |
| Boiling point | 269.6°C at 760 mmHg |
| Flash point | 121.8°C |
68441-68-9 decanoic acid, mixed esters with octanoic acid and pentaerythritol
service@apichina.com